C8H9NO4S — CID 130032595
N-(2-hydroxyphenyl)sulfonylacetamide (PubChem CID 130032595) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)sulfonylacetamide.
| Compound Name | N-(2-hydroxyphenyl)sulfonylacetamide |
|---|---|
| PubChem CID | 130032595 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | N-(2-hydroxyphenyl)sulfonylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccccc1O |
| InChI | InChI=1S/C8H9NO4S/c1-6(10)9-14(12,13)8-5-3-2-4-7(8)11/h2-5,11H,1H3,(H,9,10) |
| InChIKey | DAXQJEPDSUKXLQ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |