C14H19NO3S — CID 144593271
N-(5,6-dihydronaphthalen-1-ylsulfonyl)acetamide;ethane (PubChem CID 144593271) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-(5,6-dihydronaphthalen-1-ylsulfonyl)acetamide;ethane.
| Compound Name | N-(5,6-dihydronaphthalen-1-ylsulfonyl)acetamide;ethane |
|---|---|
| PubChem CID | 144593271 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(5,6-dihydronaphthalen-1-ylsulfonyl)acetamide;ethane |
| SMILES | CC.CC(=O)NS(=O)(=O)c1cccc2c1C=CCC2 |
| InChI | InChI=1S/C12H13NO3S.C2H6/c1-9(14)13-17(15,16)12-8-4-6-10-5-2-3-7-11(10)12;1-2/h3-4,6-8H,2,5H2,1H3,(H,13,14);1-2H3 |
| InChIKey | JJZSQQPAFZNYHR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |