About (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid
(5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid (PubChem CID 22261741) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid.
Analyze (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid?
The IUPAC name of (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid (CID 22261741) is (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid.
What is the SMILES notation for (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid?
The canonical SMILES for (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid is O=C(O)c1cccc2c1/C=C\CCCC2.
What is the InChIKey of (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid?
The InChIKey is CAMZUMDEZYHQRH-YWEYNIOJSA-N. The full InChI is InChI=1S/C13H14O2/c14-13(15)12-9-5-7-10-6-3-1-2-4-8-11(10)12/h4-5,7-9H,1-3,6H2,(H,14,15)/b8-4-.
What are the key properties of (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid?
(5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid has a molecular weight of 202.25 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-7,8,9,10-tetrahydrobenzo[8]annulene-4-carboxylic acid is sourced from PubChem (CID 22261741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).