About N-oxo-5,6-dihydronaphthalene-1-carboxamide
N-oxo-5,6-dihydronaphthalene-1-carboxamide (PubChem CID 89159076) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is N-oxo-5,6-dihydronaphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-oxo-5,6-dihydronaphthalene-1-carboxamide |
| PubChem CID | 89159076 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | N-oxo-5,6-dihydronaphthalene-1-carboxamide |
| SMILES | O=NC(=O)c1cccc2c1C=CCC2 |
| InChI | InChI=1S/C11H9NO2/c13-11(12-14)10-7-3-5-8-4-1-2-6-9(8)10/h2-3,5-7H,1,4H2 |
| InChIKey | KGIKCFRMHGUWKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-oxo-5,6-dihydronaphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxo-5,6-dihydronaphthalene-1-carboxamide?
The IUPAC name of N-oxo-5,6-dihydronaphthalene-1-carboxamide (CID 89159076) is N-oxo-5,6-dihydronaphthalene-1-carboxamide.
What is the SMILES notation for N-oxo-5,6-dihydronaphthalene-1-carboxamide?
The canonical SMILES for N-oxo-5,6-dihydronaphthalene-1-carboxamide is O=NC(=O)c1cccc2c1C=CCC2.
What is the InChIKey of N-oxo-5,6-dihydronaphthalene-1-carboxamide?
The InChIKey is KGIKCFRMHGUWKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c13-11(12-14)10-7-3-5-8-4-1-2-6-9(8)10/h2-3,5-7H,1,4H2.
What are the key properties of N-oxo-5,6-dihydronaphthalene-1-carboxamide?
N-oxo-5,6-dihydronaphthalene-1-carboxamide has a molecular weight of 187.20 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxo-5,6-dihydronaphthalene-1-carboxamide is sourced from PubChem (CID 89159076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).