C11H9NO2 — CID 89159076
N-oxo-5,6-dihydronaphthalene-1-carboxamide (PubChem CID 89159076) has the molecular formula C11H9NO2 and a molecular weight of 187.20 g/mol. Its IUPAC name is N-oxo-5,6-dihydronaphthalene-1-carboxamide.
| Compound Name | N-oxo-5,6-dihydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 89159076 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | N-oxo-5,6-dihydronaphthalene-1-carboxamide |
| SMILES | O=NC(=O)c1cccc2c1C=CCC2 |
| InChI | InChI=1S/C11H9NO2/c13-11(12-14)10-7-3-5-8-4-1-2-6-9(8)10/h2-3,5-7H,1,4H2 |
| InChIKey | KGIKCFRMHGUWKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |