C14H17NO — CID 153344139
N-(5,6-dihydronaphthalen-1-ylmethyl)propanamide (PubChem CID 153344139) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(5,6-dihydronaphthalen-1-ylmethyl)propanamide.
| Compound Name | N-(5,6-dihydronaphthalen-1-ylmethyl)propanamide |
|---|---|
| PubChem CID | 153344139 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(5,6-dihydronaphthalen-1-ylmethyl)propanamide |
| SMILES | CCC(=O)NCc1cccc2c1C=CCC2 |
| InChI | InChI=1S/C14H17NO/c1-2-14(16)15-10-12-8-5-7-11-6-3-4-9-13(11)12/h4-5,7-9H,2-3,6,10H2,1H3,(H,15,16) |
| InChIKey | FXIAZJGBDGKXNG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |