C27H40N2OS — CID 144523052
2-[2-(5,6-dihydronaphthalen-1-yl)ethylsulfanylamino]-2-methyl-N-[(7-methyl-3-bicyclo[3.3.1]nonanyl)methyl]propanamide (PubChem CID 144523052) has the molecular formula C27H40N2OS and a molecular weight of 440.70 g/mol. Its IUPAC name is 2-[2-(5,6-dihydronaphthalen-1-yl)ethylsulfanylamino]-2-methyl-N-[(7-methyl-3-bicyclo[3.3.1]nonanyl)methyl]propanamide.
| Compound Name | 2-[2-(5,6-dihydronaphthalen-1-yl)ethylsulfanylamino]-2-methyl-N-[(7-methyl-3-bicyclo[3.3.1]nonanyl)methyl]propanamide |
|---|---|
| PubChem CID | 144523052 |
| Molecular Formula | C27H40N2OS |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | 2-[2-(5,6-dihydronaphthalen-1-yl)ethylsulfanylamino]-2-methyl-N-[(7-methyl-3-bicyclo[3.3.1]nonanyl)methyl]propanamide |
| SMILES | CC1CC2CC(CNC(=O)C(C)(C)NSCCc3cccc4c3C=CCC4)CC(C1)C2 |
| InChI | InChI=1S/C27H40N2OS/c1-19-13-20-15-21(14-19)17-22(16-20)18-28-26(30)27(2,3)29-31-12-11-24-9-6-8-23-7-4-5-10-25(23)24/h5-6,8-10,19-22,29H,4,7,11-18H2,1-3H3,(H,28,30) |
| InChIKey | SQAQDOHWFYKIRC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|