C30H40N4O2 — CID 43834022
1-(5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-[(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoylamino)methyl]cyclohexyl]methyl]urea (PubChem CID 43834022) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-[(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoylamino)methyl]cyclohexyl]methyl]urea.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-[(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoylamino)methyl]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 43834022 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)-3-[[3-[(5,6,7,8-tetrahydronaphthalen-1-ylcarbamoylamino)methyl]cyclohexyl]methyl]urea |
| SMILES | O=C(NCC1CCCC(CNC(=O)Nc2cccc3c2CCCC3)C1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C30H40N4O2/c35-29(33-27-16-6-12-23-10-1-3-14-25(23)27)31-19-21-8-5-9-22(18-21)20-32-30(36)34-28-17-7-13-24-11-2-4-15-26(24)28/h6-7,12-13,16-17,21-22H,1-5,8-11,14-15,18-20H2,(H2,31,33,35)(H2,32,34,36) |
| InChIKey | ZVNRWRJELICBNW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |