C8H12N2O — CID 23171965
N-(2-aminocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 23171965) has the molecular formula C8H12N2O and a molecular weight of 152.20 g/mol. Its IUPAC name is N-(2-aminocyclohexa-1,5-dien-1-yl)acetamide.
| Compound Name | N-(2-aminocyclohexa-1,5-dien-1-yl)acetamide |
|---|---|
| PubChem CID | 23171965 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-(2-aminocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=C(N)CCC=C1 |
| InChI | InChI=1S/C8H12N2O/c1-6(11)10-8-5-3-2-4-7(8)9/h3,5H,2,4,9H2,1H3,(H,10,11) |
| InChIKey | ZZZOKJDPIJQKBI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |