C9H12N2O — CID 144831896
N-(2-aminocyclohexa-1,5-dien-1-yl)prop-2-enamide (PubChem CID 144831896) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-(2-aminocyclohexa-1,5-dien-1-yl)prop-2-enamide.
| Compound Name | N-(2-aminocyclohexa-1,5-dien-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 144831896 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-(2-aminocyclohexa-1,5-dien-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1=C(N)CCC=C1 |
| InChI | InChI=1S/C9H12N2O/c1-2-9(12)11-8-6-4-3-5-7(8)10/h2,4,6H,1,3,5,10H2,(H,11,12) |
| InChIKey | IYMOQMHIZWGMJU-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|