C9H13NO — CID 177135488
N-cyclohexa-1,5-dien-1-ylprop-2-enamide;molecular hydrogen (PubChem CID 177135488) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-ylprop-2-enamide;molecular hydrogen.
| Compound Name | N-cyclohexa-1,5-dien-1-ylprop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 177135488 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-ylprop-2-enamide;molecular hydrogen |
| SMILES | C=CC(=O)NC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C9H11NO.H2/c1-2-9(11)10-8-6-4-3-5-7-8;/h2,4,6-7H,1,3,5H2,(H,10,11);1H |
| InChIKey | RNRSRRRLJOQHBZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|