About 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea
3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea (PubChem CID 163658126) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea.
Molecular Properties
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea |
| PubChem CID | 163658126 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea |
| SMILES | CN(C(=O)NC1=CCCC=C1)C1CCCC1 |
| InChI | InChI=1S/C13H20N2O/c1-15(12-9-5-6-10-12)13(16)14-11-7-3-2-4-8-11/h3,7-8,12H,2,4-6,9-10H2,1H3,(H,14,16) |
| InChIKey | IRZYUXSMRXWYFG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea?
The IUPAC name of 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea (CID 163658126) is 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea.
What is the SMILES notation for 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea?
The canonical SMILES for 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea is CN(C(=O)NC1=CCCC=C1)C1CCCC1.
What is the InChIKey of 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea?
The InChIKey is IRZYUXSMRXWYFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-15(12-9-5-6-10-12)13(16)14-11-7-3-2-4-8-11/h3,7-8,12H,2,4-6,9-10H2,1H3,(H,14,16).
What are the key properties of 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea?
3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea has a molecular weight of 220.32 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexa-1,5-dien-1-yl-1-cyclopentyl-1-methylurea is sourced from PubChem (CID 163658126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).