C10H14N2O2 — CID 143768709
N'-cyclohexa-1,5-dien-1-yl-N-methylpropanediamide (PubChem CID 143768709) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is N'-cyclohexa-1,5-dien-1-yl-N-methylpropanediamide.
| Compound Name | N'-cyclohexa-1,5-dien-1-yl-N-methylpropanediamide |
|---|---|
| PubChem CID | 143768709 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | N'-cyclohexa-1,5-dien-1-yl-N-methylpropanediamide |
| SMILES | CNC(=O)CC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C10H14N2O2/c1-11-9(13)7-10(14)12-8-5-3-2-4-6-8/h3,5-6H,2,4,7H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | PMEAALDXTJGDHU-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|