C27H23N3O3 — CID 144544325
5-N-cyclohexa-1,5-dien-1-yl-1-N,3-N-diphenylbenzene-1,3,5-tricarboxamide (PubChem CID 144544325) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-N-cyclohexa-1,5-dien-1-yl-1-N,3-N-diphenylbenzene-1,3,5-tricarboxamide.
| Compound Name | 5-N-cyclohexa-1,5-dien-1-yl-1-N,3-N-diphenylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 144544325 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 5-N-cyclohexa-1,5-dien-1-yl-1-N,3-N-diphenylbenzene-1,3,5-tricarboxamide |
| SMILES | O=C(NC1=CCCC=C1)c1cc(C(=O)Nc2ccccc2)cc(C(=O)Nc2ccccc2)c1 |
| InChI | InChI=1S/C27H23N3O3/c31-25(28-22-10-4-1-5-11-22)19-16-20(26(32)29-23-12-6-2-7-13-23)18-21(17-19)27(33)30-24-14-8-3-9-15-24/h1-2,4-8,10-18H,3,9H2,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | HSAINCXNKKVYOZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |