C10H15NO — CID 144596584
N-cyclohexa-1,5-dien-1-yl-2-methylprop-2-enamide;molecular hydrogen (PubChem CID 144596584) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-2-methylprop-2-enamide;molecular hydrogen.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-2-methylprop-2-enamide;molecular hydrogen |
|---|---|
| PubChem CID | 144596584 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-2-methylprop-2-enamide;molecular hydrogen |
| SMILES | C=C(C)C(=O)NC1=CCCC=C1.[H][H] |
| InChI | InChI=1S/C10H13NO.H2/c1-8(2)10(12)11-9-6-4-3-5-7-9;/h4,6-7H,1,3,5H2,2H3,(H,11,12);1H |
| InChIKey | DJNWRCZORFGRIT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|