C10H11NO3S — CID 151535056
2-methyl-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)prop-2-enamide (PubChem CID 151535056) has the molecular formula C10H11NO3S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-methyl-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)prop-2-enamide.
| Compound Name | 2-methyl-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 151535056 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 2-methyl-N-(4-sulfonylcyclohexa-1,5-dien-1-yl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NC1=CCC(=S(=O)=O)C=C1 |
| InChI | InChI=1S/C10H11NO3S/c1-7(2)10(12)11-8-3-5-9(6-4-8)15(13)14/h3-5H,1,6H2,2H3,(H,11,12) |
| InChIKey | PXHBDDIJAZHJSA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|