C12H11NO5 — CID 773544
5-(2-methylprop-2-enoylamino)benzene-1,3-dicarboxylic acid (PubChem CID 773544) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(2-methylprop-2-enoylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 773544 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 5-(2-methylprop-2-enoylamino)benzene-1,3-dicarboxylic acid |
| SMILES | C=C(C)C(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H11NO5/c1-6(2)10(14)13-9-4-7(11(15)16)3-8(5-9)12(17)18/h3-5H,1H2,2H3,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | NVOBVSWSDYFEMR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|