C20H29N3O3 — CID 89029759
N-tert-butyl-3-(2,2-dimethylpropanoylamino)-5-(2-methylprop-2-enoylamino)benzamide (PubChem CID 89029759) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-tert-butyl-3-(2,2-dimethylpropanoylamino)-5-(2-methylprop-2-enoylamino)benzamide.
| Compound Name | N-tert-butyl-3-(2,2-dimethylpropanoylamino)-5-(2-methylprop-2-enoylamino)benzamide |
|---|---|
| PubChem CID | 89029759 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-tert-butyl-3-(2,2-dimethylpropanoylamino)-5-(2-methylprop-2-enoylamino)benzamide |
| SMILES | C=C(C)C(=O)Nc1cc(NC(=O)C(C)(C)C)cc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-12(2)16(24)21-14-9-13(17(25)23-20(6,7)8)10-15(11-14)22-18(26)19(3,4)5/h9-11H,1H2,2-8H3,(H,21,24)(H,22,26)(H,23,25) |
| InChIKey | RBLPZJPCBSFCNY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|