C20H31N3O3 — CID 58903239
3,5-bis(2,2-dimethylpropanoylamino)-N-propan-2-ylbenzamide (PubChem CID 58903239) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 3,5-bis(2,2-dimethylpropanoylamino)-N-propan-2-ylbenzamide.
| Compound Name | 3,5-bis(2,2-dimethylpropanoylamino)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 58903239 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 3,5-bis(2,2-dimethylpropanoylamino)-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(NC(=O)C(C)(C)C)cc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C20H31N3O3/c1-12(2)21-16(24)13-9-14(22-17(25)19(3,4)5)11-15(10-13)23-18(26)20(6,7)8/h9-12H,1-8H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | XXNOZIMYHXRVAG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |