C15H22N4O2S2 — CID 91687122
3,5-bis(propan-2-ylcarbamothioylamino)benzoic acid (PubChem CID 91687122) has the molecular formula C15H22N4O2S2 and a molecular weight of 354.50 g/mol. Its IUPAC name is 3,5-bis(propan-2-ylcarbamothioylamino)benzoic acid.
| Compound Name | 3,5-bis(propan-2-ylcarbamothioylamino)benzoic acid |
|---|---|
| PubChem CID | 91687122 |
| Molecular Formula | C15H22N4O2S2 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 3,5-bis(propan-2-ylcarbamothioylamino)benzoic acid |
| SMILES | CC(C)NC(=S)Nc1cc(NC(=S)NC(C)C)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H22N4O2S2/c1-8(2)16-14(22)18-11-5-10(13(20)21)6-12(7-11)19-15(23)17-9(3)4/h5-9H,1-4H3,(H,20,21)(H2,16,18,22)(H2,17,19,23) |
| InChIKey | VLUWZMGSMXDHPL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|