C15H18N2O4S — CID 91687112
5-(cyclohexylcarbamothioylamino)benzene-1,3-dicarboxylic acid (PubChem CID 91687112) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 5-(cyclohexylcarbamothioylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(cyclohexylcarbamothioylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91687112 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 5-(cyclohexylcarbamothioylamino)benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(NC(=S)NC2CCCCC2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O4S/c18-13(19)9-6-10(14(20)21)8-12(7-9)17-15(22)16-11-4-2-1-3-5-11/h6-8,11H,1-5H2,(H,18,19)(H,20,21)(H2,16,17,22) |
| InChIKey | YUFQWWMSWUQUPI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|