C19H28N4OS — CID 47510342
1-cyclohexyl-3-[4-(4-methylpiperazine-1-carbonyl)phenyl]thiourea (PubChem CID 47510342) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-(4-methylpiperazine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-cyclohexyl-3-[4-(4-methylpiperazine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 47510342 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-cyclohexyl-3-[4-(4-methylpiperazine-1-carbonyl)phenyl]thiourea |
| SMILES | CN1CCN(C(=O)c2ccc(NC(=S)NC3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H28N4OS/c1-22-11-13-23(14-12-22)18(24)15-7-9-17(10-8-15)21-19(25)20-16-5-3-2-4-6-16/h7-10,16H,2-6,11-14H2,1H3,(H2,20,21,25) |
| InChIKey | JHSSDVPTDMJJOD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|