C11H12N2O4S — CID 91687117
5-(ethylcarbamothioylamino)benzene-1,3-dicarboxylic acid (PubChem CID 91687117) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 5-(ethylcarbamothioylamino)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(ethylcarbamothioylamino)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 91687117 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-(ethylcarbamothioylamino)benzene-1,3-dicarboxylic acid |
| SMILES | CCNC(=S)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-2-12-11(18)13-8-4-6(9(14)15)3-7(5-8)10(16)17/h3-5H,2H2,1H3,(H,14,15)(H,16,17)(H2,12,13,18) |
| InChIKey | ZGNXYDQBLTTYIA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|