C14H18N2O — CID 142994053
1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]urea (PubChem CID 142994053) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]urea.
| Compound Name | 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]urea |
|---|---|
| PubChem CID | 142994053 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]urea |
| SMILES | C=C(C)/C=C\C(=C)NC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C14H18N2O/c1-11(2)9-10-12(3)15-14(17)16-13-7-5-4-6-8-13/h5,7-10H,1,3-4,6H2,2H3,(H2,15,16,17)/b10-9- |
| InChIKey | PRKHANGEUDFGFX-KTKRTIGZSA-N |
| XLogP | 3.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|