About 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide
2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide (PubChem CID 163875393) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide.
Molecular Properties
| Compound Name | 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide |
| PubChem CID | 163875393 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide |
| SMILES | CC(C)(N)C(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C10H16N2O/c1-10(2,11)9(13)12-8-6-4-3-5-7-8/h4,6-7H,3,5,11H2,1-2H3,(H,12,13) |
| InChIKey | POKNRZJYSQNYFE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide?
The IUPAC name of 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide (CID 163875393) is 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide.
What is the SMILES notation for 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide?
The canonical SMILES for 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide is CC(C)(N)C(=O)NC1=CCCC=C1.
What is the InChIKey of 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide?
The InChIKey is POKNRZJYSQNYFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-10(2,11)9(13)12-8-6-4-3-5-7-8/h4,6-7H,3,5,11H2,1-2H3,(H,12,13).
What are the key properties of 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide?
2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide has a molecular weight of 180.25 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-cyclohexa-1,5-dien-1-yl-2-methylpropanamide is sourced from PubChem (CID 163875393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).