C18H29N3O — CID 138460584
1-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-[(3Z)-3-(dimethylaminomethylidene)pent-4-enyl]urea (PubChem CID 138460584) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-[(3Z)-3-(dimethylaminomethylidene)pent-4-enyl]urea.
| Compound Name | 1-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-[(3Z)-3-(dimethylaminomethylidene)pent-4-enyl]urea |
|---|---|
| PubChem CID | 138460584 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 1-(3-cyclohexa-1,5-dien-1-ylpropyl)-3-[(3Z)-3-(dimethylaminomethylidene)pent-4-enyl]urea |
| SMILES | C=C/C(=C\N(C)C)CCNC(=O)NCCCC1=CCCC=C1 |
| InChI | InChI=1S/C18H29N3O/c1-4-16(15-21(2)3)12-14-20-18(22)19-13-8-11-17-9-6-5-7-10-17/h4,6,9-10,15H,1,5,7-8,11-14H2,2-3H3,(H2,19,20,22)/b16-15+ |
| InChIKey | RZFKPOCKWNMDIJ-FOCLMDBBSA-N |
| XLogP | 3.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|