About ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine
ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine (PubChem CID 142129018) has the molecular formula C18H32N2O
and a molecular weight of 292.47 g/mol. Its IUPAC name is ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine.
Molecular Properties
| Compound Name | ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine |
| PubChem CID | 142129018 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine |
| SMILES | CC.CC(=O)NC1=C(C)C=CCC=C1.CC1CCNCC1 |
| InChI | InChI=1S/C10H13NO.C6H13N.C2H6/c1-8-6-4-3-5-7-10(8)11-9(2)12;1-6-2-4-7-5-3-6;1-2/h4-7H,3H2,1-2H3,(H,11,12);6-7H,2-5H2,1H3;1-2H3 |
| InChIKey | CBVNTHZFUKUJOA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine?
The IUPAC name of ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine (CID 142129018) is ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine.
What is the SMILES notation for ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine?
The canonical SMILES for ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine is CC.CC(=O)NC1=C(C)C=CCC=C1.CC1CCNCC1.
What is the InChIKey of ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine?
The InChIKey is CBVNTHZFUKUJOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.C6H13N.C2H6/c1-8-6-4-3-5-7-10(8)11-9(2)12;1-6-2-4-7-5-3-6;1-2/h4-7H,3H2,1-2H3,(H,11,12);6-7H,2-5H2,1H3;1-2H3.
What are the key properties of ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine?
ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine has a molecular weight of 292.47 g/mol, XLogP of 3.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-(2-methylcyclohepta-1,3,6-trien-1-yl)acetamide;4-methylpiperidine is sourced from PubChem (CID 142129018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).