About 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide
3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide (PubChem CID 66796071) has the molecular formula C16H26N2O2
and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide.
Molecular Properties
| Compound Name | 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide |
| PubChem CID | 66796071 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide |
| SMILES | CC(C)CC(=O)NC1=C(NC(=O)CC(C)C)CCC=C1 |
| InChI | InChI=1S/C16H26N2O2/c1-11(2)9-15(19)17-13-7-5-6-8-14(13)18-16(20)10-12(3)4/h5,7,11-12H,6,8-10H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | SCFRMIRWAKKSSU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The IUPAC name of 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide (CID 66796071) is 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide.
What is the SMILES notation for 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The canonical SMILES for 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide is CC(C)CC(=O)NC1=C(NC(=O)CC(C)C)CCC=C1.
What is the InChIKey of 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
The InChIKey is SCFRMIRWAKKSSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2/c1-11(2)9-15(19)17-13-7-5-6-8-14(13)18-16(20)10-12(3)4/h5,7,11-12H,6,8-10H2,1-4H3,(H,17,19)(H,18,20).
What are the key properties of 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide?
3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide has a molecular weight of 278.40 g/mol, XLogP of 2.87, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-N-[2-(3-methylbutanoylamino)cyclohexa-1,3-dien-1-yl]butanamide is sourced from PubChem (CID 66796071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).