C13H14N2O — CID 144544332
N-(4-aminophenyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144544332) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N-(4-aminophenyl)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N-(4-aminophenyl)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 144544332 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-(4-aminophenyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | Nc1ccc(NC(=O)C2=CCCC=C2)cc1 |
| InChI | InChI=1S/C13H14N2O/c14-11-6-8-12(9-7-11)15-13(16)10-4-2-1-3-5-10/h2,4-9H,1,3,14H2,(H,15,16) |
| InChIKey | WSBJMWRALRRJLM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|