C20H28N2O5S2 — CID 154206907
N-[4-(dibutylsulfamoyl)naphthalen-1-yl]sulfonylacetamide (PubChem CID 154206907) has the molecular formula C20H28N2O5S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[4-(dibutylsulfamoyl)naphthalen-1-yl]sulfonylacetamide.
| Compound Name | N-[4-(dibutylsulfamoyl)naphthalen-1-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 154206907 |
| Molecular Formula | C20H28N2O5S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[4-(dibutylsulfamoyl)naphthalen-1-yl]sulfonylacetamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(S(=O)(=O)NC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C20H28N2O5S2/c1-4-6-14-22(15-7-5-2)29(26,27)20-13-12-19(28(24,25)21-16(3)23)17-10-8-9-11-18(17)20/h8-13H,4-7,14-15H2,1-3H3,(H,21,23) |
| InChIKey | NEVBSEFVWNGUOJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |