C30H37N3O5S — CID 123481443
3-(acetylsulfamoyl)-N-benzyl-5-(dibutylamino)-4-phenoxybenzamide (PubChem CID 123481443) has the molecular formula C30H37N3O5S and a molecular weight of 551.71 g/mol. Its IUPAC name is 3-(acetylsulfamoyl)-N-benzyl-5-(dibutylamino)-4-phenoxybenzamide.
| Compound Name | 3-(acetylsulfamoyl)-N-benzyl-5-(dibutylamino)-4-phenoxybenzamide |
|---|---|
| PubChem CID | 123481443 |
| Molecular Formula | C30H37N3O5S |
| Molecular Weight | 551.71 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 3-(acetylsulfamoyl)-N-benzyl-5-(dibutylamino)-4-phenoxybenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)NCc2ccccc2)cc(S(=O)(=O)NC(C)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C30H37N3O5S/c1-4-6-18-33(19-7-5-2)27-20-25(30(35)31-22-24-14-10-8-11-15-24)21-28(39(36,37)32-23(3)34)29(27)38-26-16-12-9-13-17-26/h8-17,20-21H,4-7,18-19,22H2,1-3H3,(H,31,35)(H,32,34) |
| InChIKey | PRHLMYFHFNQEPW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.71 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |