C28H36N4O4S — CID 129252570
3-(dibutylamino)-4-phenoxy-N-(2-pyridin-2-ylethyl)-5-sulfamoylbenzamide (PubChem CID 129252570) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is 3-(dibutylamino)-4-phenoxy-N-(2-pyridin-2-ylethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-(dibutylamino)-4-phenoxy-N-(2-pyridin-2-ylethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 129252570 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-(dibutylamino)-4-phenoxy-N-(2-pyridin-2-ylethyl)-5-sulfamoylbenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)NCCc2ccccn2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C28H36N4O4S/c1-3-5-18-32(19-6-4-2)25-20-22(28(33)31-17-15-23-12-10-11-16-30-23)21-26(37(29,34)35)27(25)36-24-13-8-7-9-14-24/h7-14,16,20-21H,3-6,15,17-19H2,1-2H3,(H,31,33)(H2,29,34,35) |
| InChIKey | QQTQMSGEPMMCLL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |