C27H40N4O4S — CID 91049156
3-(dibutylamino)-4-phenoxy-N-(piperidin-3-ylmethyl)-5-sulfamoylbenzamide (PubChem CID 91049156) has the molecular formula C27H40N4O4S and a molecular weight of 516.71 g/mol. Its IUPAC name is 3-(dibutylamino)-4-phenoxy-N-(piperidin-3-ylmethyl)-5-sulfamoylbenzamide.
| Compound Name | 3-(dibutylamino)-4-phenoxy-N-(piperidin-3-ylmethyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 91049156 |
| Molecular Formula | C27H40N4O4S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 3-(dibutylamino)-4-phenoxy-N-(piperidin-3-ylmethyl)-5-sulfamoylbenzamide |
| SMILES | CCCCN(CCCC)c1cc(C(=O)NCC2CCCNC2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C27H40N4O4S/c1-3-5-15-31(16-6-4-2)24-17-22(27(32)30-20-21-11-10-14-29-19-21)18-25(36(28,33)34)26(24)35-23-12-8-7-9-13-23/h7-9,12-13,17-18,21,29H,3-6,10-11,14-16,19-20H2,1-2H3,(H,30,32)(H2,28,33,34) |
| InChIKey | BXBDFPIVFKREJZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |