C22H29N3O3 — CID 129252591
3-(butylamino)-4-phenoxy-5-(pyrrolidin-3-ylmethylamino)benzoic acid (PubChem CID 129252591) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-(butylamino)-4-phenoxy-5-(pyrrolidin-3-ylmethylamino)benzoic acid.
| Compound Name | 3-(butylamino)-4-phenoxy-5-(pyrrolidin-3-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 129252591 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 3-(butylamino)-4-phenoxy-5-(pyrrolidin-3-ylmethylamino)benzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(NCC2CCNC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H29N3O3/c1-2-3-10-24-19-12-17(22(26)27)13-20(25-15-16-9-11-23-14-16)21(19)28-18-7-5-4-6-8-18/h4-8,12-13,16,23-25H,2-3,9-11,14-15H2,1H3,(H,26,27) |
| InChIKey | JHPUPEGQWKEMNR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|