C17H18N2O4SSi- — CID 164702891
CID 164702891 (PubChem CID 164702891) has the molecular formula C17H18N2O4SSi- and a molecular weight of 374.49 g/mol.
| Compound Name | CID 164702891 |
|---|---|
| PubChem CID | 164702891 |
| Molecular Formula | C17H18N2O4SSi- |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | — |
| SMILES | CCCCNc1cc(C(=O)[Si])cc(NS(=O)[O-])c1Oc1ccccc1 |
| InChI | InChI=1S/C17H19N2O4SSi/c1-2-3-9-18-14-10-12(17(20)25)11-15(19-24(21)22)16(14)23-13-7-5-4-6-8-13/h4-8,10-11,18-19H,2-3,9H2,1H3,(H,21,22)/p-1 |
| InChIKey | VABRZXNALMFYCV-UHFFFAOYSA-M |
| XLogP | 3.21 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|