C17H20N2O4S2 — CID 58033414
3-(butylamino)-4-phenoxy-5-(sulfinoamino)benzenecarbothioic S-acid (PubChem CID 58033414) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-(butylamino)-4-phenoxy-5-(sulfinoamino)benzenecarbothioic S-acid.
| Compound Name | 3-(butylamino)-4-phenoxy-5-(sulfinoamino)benzenecarbothioic S-acid |
|---|---|
| PubChem CID | 58033414 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-(butylamino)-4-phenoxy-5-(sulfinoamino)benzenecarbothioic S-acid |
| SMILES | CCCCNc1cc(C(=O)S)cc(NS(=O)O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-2-3-9-18-14-10-12(17(20)24)11-15(19-25(21)22)16(14)23-13-7-5-4-6-8-13/h4-8,10-11,18-19H,2-3,9H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | NOJSVQJCZAGWBE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|