C22H24N2O3 — CID 91370976
3-(butylamino)-5-(cyclopent-2-en-1-ylideneamino)-4-phenoxybenzoic acid (PubChem CID 91370976) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-(butylamino)-5-(cyclopent-2-en-1-ylideneamino)-4-phenoxybenzoic acid.
| Compound Name | 3-(butylamino)-5-(cyclopent-2-en-1-ylideneamino)-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 91370976 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(butylamino)-5-(cyclopent-2-en-1-ylideneamino)-4-phenoxybenzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(/N=C2/C=CCC2)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-2-3-13-23-19-14-16(22(25)26)15-20(24-17-9-7-8-10-17)21(19)27-18-11-5-4-6-12-18/h4-7,9,11-12,14-15,23H,2-3,8,10,13H2,1H3,(H,25,26)/b24-17- |
| InChIKey | BLLWSSUWYKKBMC-ULJHMMPZSA-N |
| XLogP | 5.81 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|