C24H34N4O2 — CID 139575044
3-amino-5-(butylamino)-4-phenoxy-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 139575044) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-amino-5-(butylamino)-4-phenoxy-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 3-amino-5-(butylamino)-4-phenoxy-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 139575044 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 3-amino-5-(butylamino)-4-phenoxy-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CCCCNc1cc(C(=O)NCCN2CCCCC2)cc(N)c1Oc1ccccc1 |
| InChI | InChI=1S/C24H34N4O2/c1-2-3-12-26-22-18-19(24(29)27-13-16-28-14-8-5-9-15-28)17-21(25)23(22)30-20-10-6-4-7-11-20/h4,6-7,10-11,17-18,26H,2-3,5,8-9,12-16,25H2,1H3,(H,27,29) |
| InChIKey | VXYZXTTUDPGKIP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|