C17H20N2NaO5S — CID 131864336
CID 131864336 (PubChem CID 131864336) has the molecular formula C17H20N2NaO5S and a molecular weight of 387.41 g/mol.
| Compound Name | CID 131864336 |
|---|---|
| PubChem CID | 131864336 |
| Molecular Formula | C17H20N2NaO5S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | — |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(N)(=O)=O)c1Oc1ccccc1.[Na] |
| InChI | InChI=1S/C17H20N2O5S.Na/c1-2-3-9-19-14-10-12(17(20)21)11-15(25(18,22)23)16(14)24-13-7-5-4-6-8-13;/h4-8,10-11,19H,2-3,9H2,1H3,(H,20,21)(H2,18,22,23); |
| InChIKey | IBXLSIRRIZHRAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|