C17H21N3O4S2 — CID 163692324
O-amino 3-(butylamino)-4-phenoxy-5-sulfamoylbenzenecarbothioate (PubChem CID 163692324) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is O-amino 3-(butylamino)-4-phenoxy-5-sulfamoylbenzenecarbothioate.
| Compound Name | O-amino 3-(butylamino)-4-phenoxy-5-sulfamoylbenzenecarbothioate |
|---|---|
| PubChem CID | 163692324 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | O-amino 3-(butylamino)-4-phenoxy-5-sulfamoylbenzenecarbothioate |
| SMILES | CCCCNc1cc(C(=S)ON)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-2-3-9-20-14-10-12(17(25)24-18)11-15(26(19,21)22)16(14)23-13-7-5-4-6-8-13/h4-8,10-11,20H,2-3,9,18H2,1H3,(H2,19,21,22) |
| InChIKey | MERMAZBDVHIYNB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|