C20H28N2O5SSi — CID 91697068
trimethylsilyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 91697068) has the molecular formula C20H28N2O5SSi and a molecular weight of 436.61 g/mol. Its IUPAC name is trimethylsilyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | trimethylsilyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 91697068 |
| Molecular Formula | C20H28N2O5SSi |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | trimethylsilyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)O[Si](C)(C)C)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C20H28N2O5SSi/c1-5-6-12-22-17-13-15(20(23)27-29(2,3)4)14-18(28(21,24)25)19(17)26-16-10-8-7-9-11-16/h7-11,13-14,22H,5-6,12H2,1-4H3,(H2,21,24,25) |
| InChIKey | SKGQFYOTNUIMGW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|