C25H28N2O5S — CID 66628354
2-phenylethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 66628354) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 2-phenylethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | 2-phenylethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 66628354 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 2-phenylethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OCCc2ccccc2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-2-3-15-27-22-17-20(25(28)31-16-14-19-10-6-4-7-11-19)18-23(33(26,29)30)24(22)32-21-12-8-5-9-13-21/h4-13,17-18,27H,2-3,14-16H2,1H3,(H2,26,29,30) |
| InChIKey | IGDMMGOZSQZJNI-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|