C29H36N2O6S — CID 21499022
benzyl 3-(butoxymethylsulfamoyl)-5-(butylamino)-4-phenoxybenzoate (PubChem CID 21499022) has the molecular formula C29H36N2O6S and a molecular weight of 540.68 g/mol. Its IUPAC name is benzyl 3-(butoxymethylsulfamoyl)-5-(butylamino)-4-phenoxybenzoate.
| Compound Name | benzyl 3-(butoxymethylsulfamoyl)-5-(butylamino)-4-phenoxybenzoate |
|---|---|
| PubChem CID | 21499022 |
| Molecular Formula | C29H36N2O6S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | benzyl 3-(butoxymethylsulfamoyl)-5-(butylamino)-4-phenoxybenzoate |
| SMILES | CCCCNc1cc(C(=O)OCc2ccccc2)cc(S(=O)(=O)NCOCCCC)c1Oc1ccccc1 |
| InChI | InChI=1S/C29H36N2O6S/c1-3-5-17-30-26-19-24(29(32)36-21-23-13-9-7-10-14-23)20-27(28(26)37-25-15-11-8-12-16-25)38(33,34)31-22-35-18-6-4-2/h7-16,19-20,30-31H,3-6,17-18,21-22H2,1-2H3 |
| InChIKey | UGBTZGWFNPYRON-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|