C21H28N2O4S — CID 157245988
3-(butylamino)-5-(2,2-dimethylpropanoyl)-2-phenoxybenzenesulfonamide (PubChem CID 157245988) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-(butylamino)-5-(2,2-dimethylpropanoyl)-2-phenoxybenzenesulfonamide.
| Compound Name | 3-(butylamino)-5-(2,2-dimethylpropanoyl)-2-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 157245988 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-(butylamino)-5-(2,2-dimethylpropanoyl)-2-phenoxybenzenesulfonamide |
| SMILES | CCCCNc1cc(C(=O)C(C)(C)C)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-5-6-12-23-17-13-15(20(24)21(2,3)4)14-18(28(22,25)26)19(17)27-16-10-8-7-9-11-16/h7-11,13-14,23H,5-6,12H2,1-4H3,(H2,22,25,26) |
| InChIKey | QBNMBTUHUWFVLA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|