C22H28N2O7S — CID 155795919
(1-ethoxy-1-oxopropan-2-yl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 155795919) has the molecular formula C22H28N2O7S and a molecular weight of 464.54 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 155795919 |
| Molecular Formula | C22H28N2O7S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OC(C)C(=O)OCC)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H28N2O7S/c1-4-6-12-24-18-13-16(22(26)30-15(3)21(25)29-5-2)14-19(32(23,27)28)20(18)31-17-10-8-7-9-11-17/h7-11,13-15,24H,4-6,12H2,1-3H3,(H2,23,27,28) |
| InChIKey | BOYRQMYPNZXYMZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|