C21H26N2O7S — CID 155796014
(2-ethoxy-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 155796014) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | (2-ethoxy-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 155796014 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OCC(=O)OCC)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C21H26N2O7S/c1-3-5-11-23-17-12-15(21(25)29-14-19(24)28-4-2)13-18(31(22,26)27)20(17)30-16-9-7-6-8-10-16/h6-10,12-13,23H,3-5,11,14H2,1-2H3,(H2,22,26,27) |
| InChIKey | MNULQJAPYUEAMO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|