C20H24N2O7S — CID 151975875
acetyloxymethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 151975875) has the molecular formula C20H24N2O7S and a molecular weight of 436.49 g/mol. Its IUPAC name is acetyloxymethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | acetyloxymethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 151975875 |
| Molecular Formula | C20H24N2O7S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | acetyloxymethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OCOC(C)=O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C20H24N2O7S/c1-3-4-10-22-17-11-15(20(24)28-13-27-14(2)23)12-18(30(21,25)26)19(17)29-16-8-6-5-7-9-16/h5-9,11-12,22H,3-4,10,13H2,1-2H3,(H2,21,25,26) |
| InChIKey | UBQOUDOVRQBJCJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|