C19H23N3O6S — CID 155796055
(2-amino-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 155796055) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 155796055 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OCC(N)=O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C19H23N3O6S/c1-2-3-9-22-15-10-13(19(24)27-12-17(20)23)11-16(29(21,25)26)18(15)28-14-7-5-4-6-8-14/h4-8,10-11,22H,2-3,9,12H2,1H3,(H2,20,23)(H2,21,25,26) |
| InChIKey | AYSAIWSARVWWGU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|