C23H28N2O9S — CID 155796054
1-(2-acetyloxyacetyl)oxyethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate (PubChem CID 155796054) has the molecular formula C23H28N2O9S and a molecular weight of 508.55 g/mol. Its IUPAC name is 1-(2-acetyloxyacetyl)oxyethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate.
| Compound Name | 1-(2-acetyloxyacetyl)oxyethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 155796054 |
| Molecular Formula | C23H28N2O9S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 1-(2-acetyloxyacetyl)oxyethyl 3-(butylamino)-4-phenoxy-5-sulfamoylbenzoate |
| SMILES | CCCCNc1cc(C(=O)OC(C)OC(=O)COC(C)=O)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C23H28N2O9S/c1-4-5-11-25-19-12-17(23(28)33-16(3)32-21(27)14-31-15(2)26)13-20(35(24,29)30)22(19)34-18-9-7-6-8-10-18/h6-10,12-13,16,25H,4-5,11,14H2,1-3H3,(H2,24,29,30) |
| InChIKey | QLUGKIXJWNQBFE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 160.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|