C22H26N4O4S — CID 171354301
3-(butylamino)-5-(3,5-dimethylpyrazole-1-carbonyl)-2-phenoxybenzenesulfonamide (PubChem CID 171354301) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-(butylamino)-5-(3,5-dimethylpyrazole-1-carbonyl)-2-phenoxybenzenesulfonamide.
| Compound Name | 3-(butylamino)-5-(3,5-dimethylpyrazole-1-carbonyl)-2-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 171354301 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-(butylamino)-5-(3,5-dimethylpyrazole-1-carbonyl)-2-phenoxybenzenesulfonamide |
| SMILES | CCCCNc1cc(C(=O)n2nc(C)cc2C)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C22H26N4O4S/c1-4-5-11-24-19-13-17(22(27)26-16(3)12-15(2)25-26)14-20(31(23,28)29)21(19)30-18-9-7-6-8-10-18/h6-10,12-14,24H,4-5,11H2,1-3H3,(H2,23,28,29) |
| InChIKey | JBQXEAIMRUQUED-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|