C21H28N2O5S — CID 58033467
3-(butylamino)-5-(diethylsulfamoyl)-4-phenoxybenzoic acid (PubChem CID 58033467) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 3-(butylamino)-5-(diethylsulfamoyl)-4-phenoxybenzoic acid.
| Compound Name | 3-(butylamino)-5-(diethylsulfamoyl)-4-phenoxybenzoic acid |
|---|---|
| PubChem CID | 58033467 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-(butylamino)-5-(diethylsulfamoyl)-4-phenoxybenzoic acid |
| SMILES | CCCCNc1cc(C(=O)O)cc(S(=O)(=O)N(CC)CC)c1Oc1ccccc1 |
| InChI | InChI=1S/C21H28N2O5S/c1-4-7-13-22-18-14-16(21(24)25)15-19(29(26,27)23(5-2)6-3)20(18)28-17-11-9-8-10-12-17/h8-12,14-15,22H,4-7,13H2,1-3H3,(H,24,25) |
| InChIKey | ISTIERJLARWTCW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|